N-p-Tosyl-L-phenylalanine structure
|
Common Name | N-p-Tosyl-L-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 13505-32-3 | Molecular Weight | 319.375 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 517.7±60.0 °C at 760 mmHg | |
| Molecular Formula | C16H17NO4S | Melting Point | 165 °C | |
| MSDS | N/A | Flash Point | 266.9±32.9 °C | |
| Name | N-(p-Toluenesulfonyl)-L-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 517.7±60.0 °C at 760 mmHg |
| Melting Point | 165 °C |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.375 |
| Flash Point | 266.9±32.9 °C |
| Exact Mass | 319.087830 |
| PSA | 91.85000 |
| LogP | 3.28 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | CGRCVIZBNRUWLY-HNNXBMFYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)O)cc1 |
| Storage condition | Store at RT. |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2935009090 |
| Precursor 4 | |
|---|---|
| DownStream 9 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N-tosyl-(S)-phenylalanine |
| (S)-2-(4-Methylphenylsulfonamido)-3-phenylpropanoic acid |
| MFCD00037251 |
| Tosyl-L-phenylalanine |
| N-(P-TOLUENESULFONYL)-L-PHENYLALANINE |
| N-p-Tosyl-L-phenylalanine |
| L-Phenylalanine, N-[(4-methylphenyl)sulfonyl]- |
| N-[(4-Methylphenyl)sulfonyl]-L-phenylalanine |