PF 06465469 structure
|
Common Name | PF 06465469 | ||
|---|---|---|---|---|
| CAS Number | 1407966-77-1 | Molecular Weight | 523.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H33N7O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of PF 06465469PF-06465469 is a covalent inhibitor of ITK with an IC50 of 2 nM[1]. |
| Name | 3-{1-[(3R)-1-Acryloyl-3-piperidinyl]-4-amino-1H-pyrazolo[3,4-d]py rimidin-3-yl}-N-(4-isopropyl-3-methylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Description | PF-06465469 is a covalent inhibitor of ITK with an IC50 of 2 nM[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 2 nM (ITK)[1] |
| References |
| Molecular Formula | C30H33N7O2 |
|---|---|
| Molecular Weight | 523.63 |
| Exact Mass | 523.27000 |
| PSA | 119.03000 |
| LogP | 5.70120 |
| InChIKey | CGJVMKJGKFEHTL-HSZRJFAPSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)C2=CC=CC(=C2)C3=NN(C4=NC=NC(=C34)N)[C@@H]5CCCN(C5)C(=O)C=C)C(C)C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| pf-06465469 |