β-Lactamase-IN-4 structure
|
Common Name | β-Lactamase-IN-4 | ||
|---|---|---|---|---|
| CAS Number | 1463520-91-3 | Molecular Weight | 345.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15N5O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of β-Lactamase-IN-4β-Lactamase-IN-4 is a β-lactamase inhibitor extracted from patent WO2013149121A1, compound 708. β-Lactamase-IN-4 can be used for the research of bacterial infections[1]. |
| Name | β-Lactamase-IN-4 |
|---|
| Description | β-Lactamase-IN-4 is a β-lactamase inhibitor extracted from patent WO2013149121A1, compound 708. β-Lactamase-IN-4 can be used for the research of bacterial infections[1]. |
|---|---|
| Related Catalog | |
| Target |
β-lactamase[1] |
| References |
[1]. Gu YG, et, al. 1,3,4-oxadiazole and 1,3,4-thiadiazole beta-lactamase inhibitors. WO2013149121A1. |
| Molecular Formula | C11H15N5O6S |
|---|---|
| Molecular Weight | 345.33 |
| InChIKey | MOWJLWWNZUXSGS-SFYZADRCSA-N |
| SMILES | O=C1N2CC(CCC2c2nnc(C3CNC3)o2)N1OS(=O)(=O)O |