β-Lactamase-IN-7 structure
|
Common Name | β-Lactamase-IN-7 | ||
|---|---|---|---|---|
| CAS Number | 2419903-21-0 | Molecular Weight | 313.44 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15N3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of β-Lactamase-IN-7β-Lactamase-IN-7 (compound 14) is a potent VIM-Type metallo-β-lactamase inhibitor, with Kis of 1.26 μM and 0.54 μM for VIM-1 and VIM-4, respectively. β-Lactamase-IN-7 can effectively inhibit Klebsiella pneumoniae[1]. |
| Name | β-Lactamase-IN-7 |
|---|
| Description | β-Lactamase-IN-7 (compound 14) is a potent VIM-Type metallo-β-lactamase inhibitor, with Kis of 1.26 μM and 0.54 μM for VIM-1 and VIM-4, respectively. β-Lactamase-IN-7 can effectively inhibit Klebsiella pneumoniae[1]. |
|---|---|
| Related Catalog | |
| Target |
Ki: 1.26 μM (VIM-1), 0.54 μM (VIM-4)[1] |
| References |
| Molecular Formula | C16H15N3S2 |
|---|---|
| Molecular Weight | 313.44 |
| InChIKey | LKVNAOJAHUJADA-UHFFFAOYSA-N |
| SMILES | S=c1[nH]nc(-c2ccccc2)n1CCSc1ccccc1 |