GNE-4997 structure
|
Common Name | GNE-4997 | ||
|---|---|---|---|---|
| CAS Number | 1705602-02-3 | Molecular Weight | 515.58 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H27F2N5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GNE-4997GNE-4997 is a potent and selective ITK/TSK inhibitor. |
| Name | GNE-4997 |
|---|
| Description | GNE-4997 is a potent and selective ITK/TSK inhibitor. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H27F2N5O3S |
|---|---|
| Molecular Weight | 515.58 |
| InChIKey | JNRFIKALOWSUBG-UHFFFAOYSA-N |
| SMILES | CC12Cc3[nH]nc(C(=O)Nc4cnn(C(c5ccccc5)C5CCCCS5(=O)=O)c4)c3CC1C2(F)F |