DNP-PEG4-alcohol structure
|
Common Name | DNP-PEG4-alcohol | ||
|---|---|---|---|---|
| CAS Number | 1807520-99-5 | Molecular Weight | 359.332 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 557.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C14H21N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.7±30.1 °C | |
Use of DNP-PEG4-alcoholDNP-PEG4-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | DNP-PEG4-alcohol |
|---|---|
| Synonym | More Synonyms |
| Description | DNP-PEG4-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 557.1±50.0 °C at 760 mmHg |
| Molecular Formula | C14H21N3O8 |
| Molecular Weight | 359.332 |
| Flash Point | 290.7±30.1 °C |
| Exact Mass | 359.132874 |
| LogP | 0.73 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | MOPINTOOSUROKB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NCCOCCOCCOCCO)c([N+](=O)[O-])c1 |
| MFCD28385460 |
| Ethanol, 2-[2-[2-[2-[(2,4-dinitrophenyl)amino]ethoxy]ethoxy]ethoxy]- |
| 2-[2-(2-{2-[(2,4-Dinitrophenyl)amino]ethoxy}ethoxy)ethoxy]ethanol |