Tos-O-C4-NH-Boc structure
|
Common Name | Tos-O-C4-NH-Boc | ||
|---|---|---|---|---|
| CAS Number | 180851-50-7 | Molecular Weight | 343.43800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H25NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tos-O-C4-NH-BocTos-O-C4-NH-Boc is an alkyl ether-based PROTAC linker can be used in the synthesis of PROTACs, such as BSJ-03-204 (HY-136250)[1]. |
| Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Tos-O-C4-NH-Boc is an alkyl ether-based PROTAC linker can be used in the synthesis of PROTACs, such as BSJ-03-204 (HY-136250)[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C16H25NO5S |
|---|---|
| Molecular Weight | 343.43800 |
| Exact Mass | 343.14500 |
| PSA | 93.57000 |
| LogP | 4.29040 |
| InChIKey | WBSGGWFVABZVGV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCNC(=O)OC(C)(C)C)cc1 |
| Toluene-4-sulfonic acid 4-tert-butoxy-carbonylamino-butyl ester |