Mal-C4-NH-Boc structure
|
Common Name | Mal-C4-NH-Boc | ||
|---|---|---|---|---|
| CAS Number | 124529-64-2 | Molecular Weight | 296.362 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 445.8±28.0 °C at 760 mmHg | |
| Molecular Formula | C15H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.4±24.0 °C | |
Use of Mal-C4-NH-BocMal-C4-NH-Boc is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-Methyl-2-propanyl [6-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)hexyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | Mal-C4-NH-Boc is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 445.8±28.0 °C at 760 mmHg |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.362 |
| Flash Point | 223.4±24.0 °C |
| Exact Mass | 296.173615 |
| LogP | 2.64 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.503 |
| InChIKey | HITIWLKYYJATIN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCCCN1C(=O)C=CC1=O |
| 2-Methyl-2-propanyl [6-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)hexyl]carbamate |
| MFCD22683316 |
| Carbamic acid, N-[6-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)hexyl]-, 1,1-dimethylethyl ester |