D-threo-Methylphenidate Hydrochloride structure
|
Common Name | D-threo-Methylphenidate Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 19262-68-1 | Molecular Weight | 269.76700 | |
| Density | N/A | Boiling Point | 327.6ºC at 760mmHg | |
| Molecular Formula | C14H20ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152ºC | |
| Name | D-threo-Methylphenidate Hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 327.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.76700 |
| Flash Point | 152ºC |
| Exact Mass | 269.11800 |
| PSA | 38.33000 |
| LogP | 3.21610 |
| Vapour Pressure | 0.000199mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | JUMYIBMBTDDLNG-OJERSXHUSA-N |
| SMILES | COC(=O)C(c1ccccc1)C1CCCCN1.Cl |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R22 |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| d-threo-methylphenidate hydrochloride |