Azido-PEG6-NHS ester structure
|
Common Name | Azido-PEG6-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 2055014-64-5 | Molecular Weight | 476.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H32N4O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG6-NHS esterAzido-PEG6-NHS ester is a cleavable 6 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Azido-PEG6-NHS ester is also a PEG- and Alkyl/ether based PROTAC linker that can be used in the synthesis of PROTACs[2]. |
| Name | Azido-PEG6-NHS ester |
|---|
| Description | Azido-PEG6-NHS ester is a cleavable 6 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Azido-PEG6-NHS ester is also a PEG- and Alkyl/ether based PROTAC linker that can be used in the synthesis of PROTACs[2]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[2]. |
| References |
| Molecular Formula | C19H32N4O10 |
|---|---|
| Molecular Weight | 476.48 |
| InChIKey | WXKOAPGNZNSYPW-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| Storage condition | -20°C |