SPDP-PEG6-NHS ester structure
|
Common Name | SPDP-PEG6-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1818294-32-4 | Molecular Weight | 647.758 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C27H41N3O11S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SPDP-PEG6-NHS esterSPDP-PEG6-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | SPDP-PEG6-NHS ester |
|---|---|
| Synonym | More Synonyms |
| Description | SPDP-PEG6-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C27H41N3O11S2 |
| Molecular Weight | 647.758 |
| Exact Mass | 647.218262 |
| LogP | -1.60 |
| Index of Refraction | 1.565 |
| InChIKey | KOEOEXUDNQGULJ-UHFFFAOYSA-N |
| SMILES | O=C(CCSSc1ccccn1)NCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| MFCD24539467 |
| N-{21-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-21-oxo-3,6,9,12,15,18-hexaoxahenicos-1-yl}-3-(2-pyridinyldisulfanyl)propanamide |
| Propanamide, N-[21-[(2,5-dioxo-1-pyrrolidinyl)oxy]-21-oxo-3,6,9,12,15,18-hexaoxaheneicos-1-yl]-3-(2-pyridinyldithio)- |