PROTAC Linker 9 structure
|
Common Name | PROTAC Linker 9 | ||
|---|---|---|---|---|
| CAS Number | 206265-94-3 | Molecular Weight | 403.49000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H29NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PROTAC Linker 9PROTAC Linker 9 is a PROTAC linker, which refers to the alkyl/ether composition. PROTAC Linker 9 can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| Name | 2,2-dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-yl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | PROTAC Linker 9 is a PROTAC linker, which refers to the alkyl/ether composition. PROTAC Linker 9 can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| References |
| Molecular Formula | C18H29NO7S |
|---|---|
| Molecular Weight | 403.49000 |
| Exact Mass | 403.16600 |
| PSA | 108.54000 |
| LogP | 3.72990 |
| InChIKey | IFWYDEPNEKFVRX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCNC(=O)OC(C)(C)C)cc1 |
| t-Butyl-N-(2-{2-[2-(tosyloxy)-ethoxy]-ethoxy}-ethyl)-carbamate |