Ac-Leu-Glu-Thr-Asp-AFC structure
|
Common Name | Ac-Leu-Glu-Thr-Asp-AFC | ||
|---|---|---|---|---|
| CAS Number | 210345-02-1 | Molecular Weight | 729.655 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1113.8±65.0 °C at 760 mmHg | |
| Molecular Formula | C31H38F3N5O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 627.4±34.3 °C | |
Use of Ac-Leu-Glu-Thr-Asp-AFCAc-LETD-AFC is a caspase-8 fluorogenic substrate. Ac-LETD-AFC can measure caspase-8 fluorogenic activity and can be used for the research of cancer cell apoptosis and oxidative stress metabolism[1]. |
| Name | 4-[(2-acetamido-4-methylpentanoyl)amino]-5-[[1-[[3-carboxy-1-oxo-1-[[2-oxo-4-(trifluoromethyl)chromen-7-yl]amino]propan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Ac-LETD-AFC is a caspase-8 fluorogenic substrate. Ac-LETD-AFC can measure caspase-8 fluorogenic activity and can be used for the research of cancer cell apoptosis and oxidative stress metabolism[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Guidelines (Following is our recommended protocol. This protocol only provides a guideline, and should be modified according to your specific needs). Caspase activity assay[1]: 1. Incubate the cells according to your normal protocol. 2. Wash cells once with PBS and centrifugate. 3. Resuspend cells in PBS at a concentration of 1× 107 cells/mL. 4. Prepare the standard reaction buffer which includ 100 μM caspase-8 substrate AC-LETD-AFC. Prepare correspounding standard reaction buffer according to your protocol. 5. Add 15 ul of the cells suspension to a microplate, and mixed with the appropriate peptide substrate dissolved in a standard reaction buffer. 6. Measure substrate cleavage with a microplate reader with excitation wavelength of 360 nm and emission at 460 nm. |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1113.8±65.0 °C at 760 mmHg |
| Molecular Formula | C31H38F3N5O12 |
| Molecular Weight | 729.655 |
| Flash Point | 627.4±34.3 °C |
| Exact Mass | 729.246887 |
| PSA | 270.54000 |
| LogP | 1.76 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | KTZOWCXXAYFIFT-XSSXFGQWSA-N |
| SMILES | CC(=O)NC(CC(C)C)C(=O)NC(CCC(=O)O)C(=O)NC(C(=O)NC(CC(=O)O)C(=O)Nc1ccc2c(C(F)(F)F)cc(=O)oc2c1)C(C)O |
| Ac-Leu-Glu-Thr-Asp-7-Amino-4-trifluoromethylcoumarin |
| AFC157 |
| Ac-LGlutD-AFC |
| Ac-Leu-Glu-Thr-Asp-AFC |
| L-α-Asparagine, N-acetyl-L-leucyl-L-α-glutamyl-L-threonyl-N-[2-oxo-4-(trifluoromethyl)-2H-1-benzopyran-7-yl]- |
| N-Acetyl-L-leucyl-L-α-glutamyl-L-threonyl-N-[2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl]-L-α-asparagine |