Procyanidin B3 structure
|
Common Name | Procyanidin B3 | ||
|---|---|---|---|---|
| CAS Number | 23567-23-9 | Molecular Weight | 578.520 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 955.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C30H26O12 | Melting Point | 218-219℃ | |
| MSDS | N/A | Flash Point | 531.6±34.3 °C | |
Use of Procyanidin B3Procyanidin B3 is a natural product, acts as a specific HAT inhibitor, binds to the other site of p300 instead of the active site, selectively inhibits p300-mediated androgen receptor acetylation. Procyanidin B3 has no effect on HDAC or HMT (histone methyltransferase)[1]. |
| Name | procyanidin B3 |
|---|---|
| Synonym | More Synonyms |
| Description | Procyanidin B3 is a natural product, acts as a specific HAT inhibitor, binds to the other site of p300 instead of the active site, selectively inhibits p300-mediated androgen receptor acetylation. Procyanidin B3 has no effect on HDAC or HMT (histone methyltransferase)[1]. |
|---|---|
| Related Catalog | |
| Target |
p300[1] |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 955.3±65.0 °C at 760 mmHg |
| Melting Point | 218-219℃ |
| Molecular Formula | C30H26O12 |
| Molecular Weight | 578.520 |
| Flash Point | 531.6±34.3 °C |
| Exact Mass | 578.142456 |
| PSA | 220.76000 |
| LogP | 0.30 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.803 |
| InChIKey | XFZJEEAOWLFHDH-AVFWISQGSA-N |
| SMILES | Oc1cc(O)c2c(c1)OC(c1ccc(O)c(O)c1)C(O)C2c1c(O)cc(O)c2c1OC(c1ccc(O)c(O)c1)C(O)C2 |
| Storage condition | ?20°C |
| Proanthocyanidin B3 |
| Procyanidin B2 |
| (2R,2'R,3R,3'R,4R)-2,2'-Bis(3,4-dihydroxyphenyl)-3,3',4,4'-tetrahydro-2H,2'H-4,8'-bichromene-3,3',5,5',7,7'-hexol |
| (2R,3S)-2-(3,4-dihydroxyphenyl)-8-[(2R,3S,4S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
| 4,8"-Bi-[(+)-epicatechin] |
| Procyanidin B-3 |
| Proanthocyanidin |
| UNII-L88HKE854X |
| 2,3-trans-proanthocyanidin |
| [4,8'-Bi-2H-1-benzopyran]-3,3',5,5',7,7'-hexol, 2,2'-bis(3,4-dihydroxyphenyl)-3,3',4,4'-tetrahydro-, (2R,2'R,3R,3'R,4R)- |