Thalidomide-PEG4-NH2 hydrochloride structure
|
Common Name | Thalidomide-PEG4-NH2 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2387510-82-7 | Molecular Weight | 485.92 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H28ClN3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thalidomide-PEG4-NH2 hydrochlorideThalidomide-PEG4-NH2 hydrochloride is a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide based cereblon ligand and a linker used in PROTAC technology[1]. |
| Name | Thalidomide-PEG4-NH2 hydrochloride |
|---|
| Description | Thalidomide-PEG4-NH2 hydrochloride is a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide based cereblon ligand and a linker used in PROTAC technology[1]. |
|---|---|
| Related Catalog | |
| Target |
Cereblon |
| Molecular Formula | C21H28ClN3O8 |
|---|---|
| Molecular Weight | 485.92 |
| InChIKey | NDHMOOQETYCWFG-UHFFFAOYSA-N |
| SMILES | Cl.NCCOCCOCCOCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Hazard Codes | Xi |
|---|