Thalidomide-NH-C8-NH2 hydrochloride
Modify Date: 2025-08-25 17:59:48
Thalidomide-NH-C8-NH2 hydrochloride structure
|
Common Name | Thalidomide-NH-C8-NH2 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2446474-06-0 | Molecular Weight | 436.93 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H29ClN4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thalidomide-NH-C8-NH2 hydrochlorideThalidomide-NH-C8-NH2 hydrochloride is a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide based cereblon ligand and a linker used in PROTAC technology[1]. |
| Name | Thalidomide-NH-C8-NH2 hydrochloride |
|---|
| Description | Thalidomide-NH-C8-NH2 hydrochloride is a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide based cereblon ligand and a linker used in PROTAC technology[1]. |
|---|---|
| Related Catalog | |
| Target |
Cereblon |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[2]. |
| References |
| Molecular Formula | C21H29ClN4O4 |
|---|---|
| Molecular Weight | 436.93 |
| InChIKey | HLOLYBRNISBSJC-UHFFFAOYSA-N |
| SMILES | Cl.NCCCCCCCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |