MIF-IN-2 structure
|
Common Name | MIF-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 2756410-57-6 | Molecular Weight | 319.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MIF-IN-2MIF-IN-2 is a migration inhibitory factor (MIF) inhibitor extracted from patent WO2021258272A1 compound 1. MIF-IN-2 can be used for the research of immune inflammation-related diseases[1]. |
| Name | MIF-IN-2 |
|---|
| Description | MIF-IN-2 is a migration inhibitory factor (MIF) inhibitor extracted from patent WO2021258272A1 compound 1. MIF-IN-2 can be used for the research of immune inflammation-related diseases[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. FAN G, et, al. Compounds and their uses as mif inhibitors. WO2021258272A1. |
| Molecular Formula | C14H10ClN3O4 |
|---|---|
| Molecular Weight | 319.70 |
| InChIKey | MPFTVNQLHQVPKM-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Nc2nnc(-c3ccco3)o2)c(Cl)c1 |