N'-phenyl-4-methylbenzhydrazide structure
|
Common Name | N'-phenyl-4-methylbenzhydrazide | ||
|---|---|---|---|---|
| CAS Number | 39719-02-3 | Molecular Weight | 226.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-phenyl-4-methylbenzhydrazide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14N2O |
|---|---|
| Molecular Weight | 226.27400 |
| Exact Mass | 226.11100 |
| PSA | 41.13000 |
| LogP | 3.21580 |
| InChIKey | GWTUCZAESJFIAZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)NNc2ccccc2)cc1 |
| HS Code | 2928000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| p-Toluylsaeure-phenylhydrazid |
| 4-Methyl-benzoesaeure-(N'-phenyl-hydrazid) |
| p-toluic acid phenylhydrazide |
| β-p-Toluyl-phenylhydrazin |
| N'-p-Toluyl-N-phenyl-hydrazin |
| 4-methyl-benzoic acid-(N'-phenyl-hydrazide) |