Hydroxy-PEG3-CH2-Boc structure
|
Common Name | Hydroxy-PEG3-CH2-Boc | ||
|---|---|---|---|---|
| CAS Number | 518044-31-0 | Molecular Weight | 264.315 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 351.2±27.0 °C at 760 mmHg | |
| Molecular Formula | C12H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.9±17.2 °C | |
Use of Hydroxy-PEG3-CH2-BocHydroxy-PEG3-CH2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-Methyl-2-propanyl {2-[2-(2-hydroxyethoxy)ethoxy]ethoxy}acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Hydroxy-PEG3-CH2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 351.2±27.0 °C at 760 mmHg |
| Molecular Formula | C12H24O6 |
| Molecular Weight | 264.315 |
| Flash Point | 121.9±17.2 °C |
| Exact Mass | 264.157288 |
| LogP | 0.11 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | YZXRUQCLSBHYHG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCO |
| 2-Methyl-2-propanyl {2-[2-(2-hydroxyethoxy)ethoxy]ethoxy}acetate |
| Acetic acid, 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-, 1,1-dimethylethyl ester |
| MFCD27977510 |