Hydroxy-PEG4-CH2-Boc structure
|
Common Name | Hydroxy-PEG4-CH2-Boc | ||
|---|---|---|---|---|
| CAS Number | 169751-72-8 | Molecular Weight | 308.368 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 393.1±32.0 °C at 760 mmHg | |
| Molecular Formula | C14H28O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.9±18.6 °C | |
Use of Hydroxy-PEG4-CH2-BocHydroxy-PEG4-CH2-Boc is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | 2-Methyl-2-propanyl 14-hydroxy-3,6,9,12-tetraoxatetradecan-1-oate |
|---|---|
| Synonym | More Synonyms |
| Description | Hydroxy-PEG4-CH2-Boc is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 393.1±32.0 °C at 760 mmHg |
| Molecular Formula | C14H28O7 |
| Molecular Weight | 308.368 |
| Flash Point | 132.9±18.6 °C |
| Exact Mass | 308.183502 |
| LogP | -0.25 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.452 |
| InChIKey | NFZDNYVRTZIPKC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCO |
| 14-Hydroxy-3,6,9,12-tétraoxatétradécan-1-oate de 2-méthyl-2-propanyle |
| 3,6,9,12-Tetraoxatetradecan-1-oic acid, 14-hydroxy-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 14-hydroxy-3,6,9,12-tetraoxatetradecan-1-oate |
| 2-Methyl-2-propanyl-14-hydroxy-3,6,9,12-tetraoxatetradecan-1-oat |