Ethanone,1-(3,6-dihydroxy-2,4-dimethoxyphenyl)- structure
|
Common Name | Ethanone,1-(3,6-dihydroxy-2,4-dimethoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6962-57-8 | Molecular Weight | 212.19900 | |
| Density | 1.279g/cm3 | Boiling Point | 425.4ºC at 760 mmHg | |
| Molecular Formula | C10H12O5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 171.2ºC | |
| Name | 3,6-dihydroxy-2,4-dimethoxyacetophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.279g/cm3 |
|---|---|
| Boiling Point | 425.4ºC at 760 mmHg |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.19900 |
| Flash Point | 171.2ºC |
| Exact Mass | 212.06800 |
| PSA | 75.99000 |
| LogP | 1.31760 |
| Index of Refraction | 1.557 |
| InChIKey | JQIYCACQAOMVTI-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c(C(C)=O)c(OC)c1O |
| HS Code | 2914509090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,5-dihydroxy-4,6-dimethoxyacetophenone |
| 3',6'-dihydroxy-2',4'-dimethoxyacetophenone |