(D-Pro2,D-Trp7·9)-Substance P acetate salt structure
|
Common Name | (D-Pro2,D-Trp7·9)-Substance P acetate salt | ||
|---|---|---|---|---|
| CAS Number | 80434-86-2 | Molecular Weight | 1515.82000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C74H106N20O13S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of (D-Pro2,D-Trp7·9)-Substance P acetate salt[D-Pro2,D-Trp7,9] Substance P, a Substance P (HY-P0201) analogue, is a weak agonist and a potent, specific, competitive Substance P antagonist[1][2]. |
| Name | [d-pro2, d-trp7,9]-substance p |
|---|---|
| Synonym | More Synonyms |
| Description | [D-Pro2,D-Trp7,9] Substance P, a Substance P (HY-P0201) analogue, is a weak agonist and a potent, specific, competitive Substance P antagonist[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | [D-Pro2,D-Trp7,9] Substance P decreases proliferation only in a few cell lines, and only in the highest concentration (100 µM). [D-Pro2,D-Trp7,9] Substance P displays a significantly weaker antiproliferative action than Aprepitant (HY-10052) on cancer or normal cell lines[3]. |
| In Vivo | [D-Pro2,D-Trp7,9] Substance P (0-30 nmol, Intravitreal injection) greatly reduces not only the effects of exogenous Substance P (HY-P0201) but also the inflammatory response to trauma to the eye[1]. [D-Pro2,D-Trp7,9] Substance P specifically antagonizes the contractile effects of Substance P on the guinea-pig isolated taenia coli[2]. Animal Model: Adult pigmented rabbits (1.5-3 kg)[1] Dosage: 0.03, 0.3, 3, and 30 nmol Administration: Intravitreal injection or topical application onto the eye, 60 μL Result: Reduced the inflammatory response to Substance P. Dependently reduced the inflammatory response to infrared irradiation. In itself, intravitreal injection of low doses of [D-Pro2, D-Trp7'9]SP had no effects on the eye. |
| References |
| Molecular Formula | C74H106N20O13S |
|---|---|
| Molecular Weight | 1515.82000 |
| Exact Mass | 1514.80000 |
| PSA | 573.51000 |
| LogP | 6.76800 |
| InChIKey | ARZXOJGZBACSSO-OLMCGDJQSA-N |
| SMILES | CSCCC(NC(=O)C(CC(C)C)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1ccccc1)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCCN)NC(=O)C1CCCN1C(=O)C(N)CCCN=C(N)N)C(N)=O |
| 2-Pro-7,9-Trp-substance p |
| 2-Pro-7,9-Trp-sp |
| Pttsp |
| Pt-sp |
| <D-Pro2,D-Trp7,9>-SP |
| dt79 |
| [DPro2,DTrp7,9] Substance P |