Polymyxin B1 Isoleucine structure
|
Common Name | Polymyxin B1 Isoleucine | ||
|---|---|---|---|---|
| CAS Number | 80469-10-9 | Molecular Weight | 1203.477 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 1571.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C56H98N16O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 904.1±34.3 °C | |
Use of Polymyxin B1 IsoleucinePolymyxin B1 Isoleucine differs from polymyxin B1 by having isoleucine rather than leucine as a component of the cyclic peptide |
| Name | Polymyxin B1 Isoleucine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 1571.4±65.0 °C at 760 mmHg |
| Molecular Formula | C56H98N16O13 |
| Molecular Weight | 1203.477 |
| Flash Point | 904.1±34.3 °C |
| Exact Mass | 1202.749878 |
| PSA | 490.66000 |
| LogP | -2.87 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | YAMZKVXJHUGXEM-DCFHCFNESA-N |
| SMILES | CCC(C)CCCCC(=O)NC(CCN)C(=O)NC(C(=O)NC(CCN)C(=O)NC1CCNC(=O)C(C(C)O)NC(=O)C(CCN)NC(=O)C(CCN)NC(=O)C(C(C)CC)NC(=O)C(Cc2ccccc2)NC(=O)C(CCN)NC1=O)C(C)O |
| Octanamide, N-[(1S)-3-amino-1-[[[(1S,2R)-1-[[[(1S)-3-amino-1-[[[(3S,6S,9S,12S,15R,18S,21S)-6,9,18-tris(2-aminoethyl)-3-[(1R)-1-hydroxyethyl]-12-[(1S)-1-methylpropyl]-2,5,8,11,14,17,20-heptaoxo-15-(phenylmethyl)-1,4,7,10,13,16,19-heptaazacyclotricos-21-yl]amino]carbonyl]propyl]amino]carbonyl]-2-hydroxypropyl]amino]carbonyl]propyl]-6-methyl- |
| N-[(2S)-4-Amino-1-{[(2S,3R)-1-{[(2S)-4-amino-1-oxo-1-({(3S,6S,9S,12S,15R,18S,21S)-6,9,18-tris(2-aminoethyl)-15-benzyl-12-[(2S)-2-butanyl]-3-[(1R)-1-hydroxyethyl]-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptaazacyclotricosan-21-yl}amino)-2-butanyl]amino}-3-hydroxy-1-oxo-2-butanyl]amino}-1-oxo-2-butanyl]-6-methyloctanamide |
| Polymyxin II |
| Polymyxin Ile-B1 |