Azido-PEG6-alcohol structure
|
Common Name | Azido-PEG6-alcohol | ||
|---|---|---|---|---|
| CAS Number | 86770-69-6 | Molecular Weight | 307.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H25N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG6-alcoholAzido-PEG6-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG6-alcohol is also a non-cleavable 6 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[2]. |
| Name | 2[-2-(2-{2-[2-(2-hydroxyethoxy)-ethoxy]-ethoxy}-ethoxy)-ethoxy]- ethyl azide |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG6-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG6-alcohol is also a non-cleavable 6 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[2]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Non-cleavable |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[2]. |
| References |
| Molecular Formula | C12H25N3O6 |
|---|---|
| Molecular Weight | 307.34300 |
| Exact Mass | 307.17400 |
| PSA | 116.13000 |
| InChIKey | DPRULTZUGLDCPZ-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCO |
| Storage condition | -20°C |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 17-azido-3,6,9,12,15-pentaoxaheptadecan-1-ol |
| 2-[2-(2-{2-[2-(2-azido-ethoxy)-ethoxy]-ethoxy}-ethoxy)-ethoxy]-ethanol |
| 3,6,9,12,15-pentaoxa-17-azidoheptadecan-1-ol |
| 17-azido-3,6,9,12,15-pentaoxa-1-heptadecanol |
| 23-azido-3,6,9,12,15,-heptaoxatricosan-1-ol |
| 17-azido-3,6,9,12,15-pentaoxaheptadecanol |