m-PEG7-NHS ester structure
|
Common Name | m-PEG7-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 874208-92-1 | Molecular Weight | 465.49200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H35NO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of m-PEG7-NHS esterm-PEG7-NHS ester is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | 3-{2-[2-(2-{2-[2-(2-methoxy-ethoxy)-ethoxy]-ethoxy}-ethoxy)-ethoxy]-ethoxy}-propionic acid 2,5-dioxo-pyrrolidin-1-yl ester |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG7-NHS ester is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Molecular Formula | C20H35NO11 |
|---|---|
| Molecular Weight | 465.49200 |
| Exact Mass | 465.22100 |
| PSA | 128.29000 |
| InChIKey | WFZQJHMGKLLCOJ-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| Hazard Codes | Xi |
|---|
| m-peg7-nhs ester |