Azido-PEG4-Amine structure
|
Common Name | Azido-PEG4-Amine | ||
|---|---|---|---|---|
| CAS Number | 951671-92-4 | Molecular Weight | 262.30600 | |
| Density | 1.10 g/mL | Boiling Point | N/A | |
| Molecular Formula | C10H22N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG4-AminePROTAC Linker 20 is a polyethylene glycol (PEG)-based PROTAC linker. PROTAC Linker 20 can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| Name | 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Description | PROTAC Linker 20 is a polyethylene glycol (PEG)-based PROTAC linker. PROTAC Linker 20 can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| References |
| Density | 1.10 g/mL |
|---|---|
| Molecular Formula | C10H22N4O4 |
| Molecular Weight | 262.30600 |
| Exact Mass | 262.16400 |
| PSA | 112.69000 |
| LogP | 0.47486 |
| Appearance of Characters | liquid |
| Index of Refraction | 1.4670 to 1.4710 |
| InChIKey | ZMBGKXBIVYXREN-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCN |
| Storage condition | 2-8°C |
| RIDADR | UN 2735 8/PG III |
|---|---|
| Packaging Group | III |
| Hazard Class | 8 |
| O-(2-Aminoethyl)-O'-(2-azidoethyl)triethylene Glycol |
| 14-Azido-3,6,9,12-tetraoxatetradecan-1-amine |
| Azido-PEG4-Amine |
| O-(2-Aminoethyl)-O’-(2-azidoethyl)triethylene Glycol |