2-Aminopurine-O-Ph-NHCO-C3-NHS ester structure
|
Common Name | 2-Aminopurine-O-Ph-NHCO-C3-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1060652-57-4 | Molecular Weight | 481.46 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23N7O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-Aminopurine-O-Ph-NHCO-C3-NHS ester2-Aminopurine-O-Ph-NHCO-C3-NHS ester (BG-GLA-NHS) is an amine-reactive building block. 2-Aminopurine-O-Ph-NHCO-C3-NHS ester can be used to modify viral capsids surface, and the synthesis of SNAP-tag substrates[1]. |
| Name | 2-Aminopurine-O-Ph-NHCO-C3-NHS ester |
|---|
| Description | 2-Aminopurine-O-Ph-NHCO-C3-NHS ester (BG-GLA-NHS) is an amine-reactive building block. 2-Aminopurine-O-Ph-NHCO-C3-NHS ester can be used to modify viral capsids surface, and the synthesis of SNAP-tag substrates[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Heppenstall, et al. Modified viral particles for gene therapy. Patent. WO2022101363. |
| Molecular Formula | C22H23N7O6 |
|---|---|
| Molecular Weight | 481.46 |
| InChIKey | NABGZMFQLSWFAE-UHFFFAOYSA-N |
| SMILES | Nc1nc(OCc2ccc(CNC(=O)CCCC(=O)ON3C(=O)CCC3=O)cc2)c2[nH]cnc2n1 |