N3-C3-NHS ester structure
|
Common Name | N3-C3-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 943858-70-6 | Molecular Weight | 226.18900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N3-C3-NHS esterN3-C3-NHS ester is a noncleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). |
| Name | Butanoic acid, 4-azido-, 2,5-dioxo-1-pyrrolidinyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | N3-C3-NHS ester is a noncleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). |
|---|---|
| Related Catalog | |
| Target |
Noncleavable |
| References |
| Molecular Formula | C8H10N4O4 |
|---|---|
| Molecular Weight | 226.18900 |
| Exact Mass | 226.07000 |
| PSA | 113.43000 |
| LogP | 0.07476 |
| InChIKey | YYULROINNKAMIB-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCCC(=O)ON1C(=O)CCC1=O |
| HS Code | 2929909090 |
|---|
| HS Code | 2929909090 |
|---|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-azidobutyrate-n-hydroxysuccinimide ester |