m-PEG4-O-NHS ester structure
|
Common Name | m-PEG4-O-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 147912-03-6 | Molecular Weight | 349.33400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H23NO9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of m-PEG4-O-NHS esterm-PEG4-O-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 11-methoxy-3,6,9-trioxaundecanyl N-succinimidyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG4-O-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C14H23NO9 |
|---|---|
| Molecular Weight | 349.33400 |
| Exact Mass | 349.13700 |
| PSA | 109.83000 |
| InChIKey | UCHQKIQOBVMTDI-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOC(=O)ON1C(=O)CCC1=O |
| carbonic acid 2,5-dioxo-pyrrolidin-1-yl ester 2-{2-[2-(2-methoxy-ethoxy)-ethoxy]-ethoxy}-ethyl ester |