Tos-PEG2-O-Propargyl structure
|
Common Name | Tos-PEG2-O-Propargyl | ||
|---|---|---|---|---|
| CAS Number | 1119249-30-7 | Molecular Weight | 298.35500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tos-PEG2-O-PropargylTos-PEG2-O-Propargyl is a PEG-based PROTAC linker can be used in the synthesis of Thalidomide-O-PEG2-propargyl (HY-126458)[1]. |
| Name | 2-[2-(prop-2-yn-1-yloxy)ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Tos-PEG2-O-Propargyl is a PEG-based PROTAC linker can be used in the synthesis of Thalidomide-O-PEG2-propargyl (HY-126458)[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C14H18O5S |
|---|---|
| Molecular Weight | 298.35500 |
| Exact Mass | 298.08700 |
| PSA | 70.21000 |
| LogP | 2.44750 |
| InChIKey | XOLBARIQCXNLPS-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOS(=O)(=O)c1ccc(C)cc1 |
| Hazard Codes | Xi |
|---|
| 2-(2-(prop-2-ynyloxy)ethoxy)ethyl 4-methylbenzenesulfonate |
| 3,6-dioxanon-8-yn-1-yl p-toluenesulfonate |
| 1-O-tosyl-3,6-dioxanon-8-yne |