TBDMS-PEG4-OH structure
|
Common Name | TBDMS-PEG4-OH | ||
|---|---|---|---|---|
| CAS Number | 134179-40-1 | Molecular Weight | 308.486 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 349.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C14H32O5Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.2±23.7 °C | |
Use of TBDMS-PEG4-OHTBDMS-PEG4-OH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2,2,3,3-Tetramethyl-4,7,10,13-tetraoxa-3-silapentadecan-15-ol |
|---|---|
| Synonym | More Synonyms |
| Description | TBDMS-PEG4-OH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 349.6±27.0 °C at 760 mmHg |
| Molecular Formula | C14H32O5Si |
| Molecular Weight | 308.486 |
| Flash Point | 165.2±23.7 °C |
| Exact Mass | 308.201904 |
| LogP | 1.42 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.441 |
| InChIKey | KZFZMISGZPOLJM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCCOCCOCCO |
| 2,2,3,3-Tetramethyl-4,7,10,13-tetraoxa-3-silapentadecan-15-ol |
| 4,7,10,13-Tetraoxa-3-silapentadecan-15-ol, 2,2,3,3-tetramethyl- |
| MFCD25424114 |