Bromo-PEG6-Boc structure
|
Common Name | Bromo-PEG6-Boc | ||
|---|---|---|---|---|
| CAS Number | 1393330-41-0 | Molecular Weight | 473.396 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 489.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C19H37BrO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.1±27.3 °C | |
Use of Bromo-PEG6-BocBromo-PEG6-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Bromo-PEG6-t-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Bromo-PEG6-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 489.9±40.0 °C at 760 mmHg |
| Molecular Formula | C19H37BrO8 |
| Molecular Weight | 473.396 |
| Flash Point | 250.1±27.3 °C |
| Exact Mass | 472.167175 |
| LogP | 0.60 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | MCRDORXGTMATBG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCBr |
| 3,6,9,12,15,18-Hexaoxaheneicosan-21-oic acid, 1-bromo-, 1,1-dimethylethyl ester |
| MFCD22574809 |
| 2-Methyl-2-propanyl 1-bromo-3,6,9,12,15,18-hexaoxahenicosan-21-oate |