PF 06273340 structure
|
Common Name | PF 06273340 | ||
|---|---|---|---|---|
| CAS Number | 1402438-74-7 | Molecular Weight | 479.919 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H22ClN7O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of PF 06273340PF-06273340 is a potent, selective, orally bioavailable and peripherally restricted pan Trk inhibitor[1]. |
| Name | I136775ABW |
|---|---|
| Synonym | More Synonyms |
| Description | PF-06273340 is a potent, selective, orally bioavailable and peripherally restricted pan Trk inhibitor[1]. |
|---|---|
| Related Catalog | |
| Target |
TRK |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C23H22ClN7O3 |
| Molecular Weight | 479.919 |
| Exact Mass | 479.147278 |
| LogP | 0.92 |
| Index of Refraction | 1.711 |
| InChIKey | BPIWZDNVMQQBQX-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)n1cc(C(=O)c2cncc(NC(=O)Cc3ccc(Cl)cn3)c2)c2cnc(N)nc21 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P301 + P312 + P330 |
| RIDADR | NONH for all modes of transport |
| PF-06273340 |
| 2-Pyridineacetamide, N-[5-[[2-amino-7-(2-hydroxy-1,1-dimethylethyl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]carbonyl]-3-pyridinyl]-5-chloro- |
| N-(5-{[2-Amino-7-(1-hydroxy-2-methyl-2-propanyl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]carbonyl}-3-pyridinyl)-2-(5-chloro-2-pyridinyl)acetamide |
| I136775ABW |