UNC 2327 structure
|
Common Name | UNC 2327 | ||
|---|---|---|---|---|
| CAS Number | 1426152-53-5 | Molecular Weight | 319.382 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H17N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of UNC 2327UNC2327 is an allosteric inhibitor of protein arginine methyltransferase 3 (PRMT3). |
| Name | UNC2327 |
|---|---|
| Synonym | More Synonyms |
| Description | UNC2327 is an allosteric inhibitor of protein arginine methyltransferase 3 (PRMT3). |
|---|---|
| Related Catalog | |
| Target |
PRMT3 |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.382 |
| Exact Mass | 319.110291 |
| LogP | 1.71 |
| Index of Refraction | 1.686 |
| InChIKey | MYTRGTBDVGKKRO-UHFFFAOYSA-N |
| SMILES | O=C(NCC(=O)N1CCCCC1)Nc1ccc2nnsc2c1 |
| UNC2327 |
| Urea, N-1,2,3-benzothiadiazol-6-yl-N'-[2-oxo-2-(1-piperidinyl)ethyl]- |
| 1-(1,2,3-Benzothiadiazol-6-yl)-3-[2-oxo-2-(1-piperidinyl)ethyl]urea |