7-Methoxyisoflavone structure
|
Common Name | 7-Methoxyisoflavone | ||
|---|---|---|---|---|
| CAS Number | 1621-56-3 | Molecular Weight | 252.26500 | |
| Density | 1.24g/cm3 | Boiling Point | 421.2ºC at 760 mmHg | |
| Molecular Formula | C16H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.3ºC | |
Use of 7-Methoxyisoflavone7-Methoxyisoflavone is an isoflavone derivative and also an activator of adenosine monophosphate-activated protein kinase (AMPK). |
| Name | 7-methoxy-3-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Methoxyisoflavone is an isoflavone derivative and also an activator of adenosine monophosphate-activated protein kinase (AMPK). |
|---|---|
| Related Catalog | |
| Target |
AMPK[1] |
| In Vitro | 7-Methoxyisoflavone is an isoflavone derivative and also an activator of adenosine monophosphate-activated protein kinase (AMPK). When serum-starved cells are treated with 10 % FBS in the presence of 7-methoxyisoflavone, the serum-induced decrease in AMPK phosphorylation is prevented[1]. |
| References |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 421.2ºC at 760 mmHg |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.26500 |
| Flash Point | 200.3ºC |
| Exact Mass | 252.07900 |
| PSA | 39.44000 |
| LogP | 3.46860 |
| Vapour Pressure | 2.66E-07mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | IECSQLKWZBEUGA-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(=O)c(-c3ccccc3)coc2c1 |
| Storage condition | 2-8℃ |
| HS Code | 2932999099 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 7-methoxy-3-phenylchromone |
| 7-Methoxy-3-phenyl-chromen-4-on |
| 7-methoxy-3-phenyl-4H-1-benzopyran-4-one |
| 7-methoxy-3-phenyl-4H-chromen-4-one |
| 7-Methoxy Isoflavone |
| 7-methoxy-3-phenyl-chromen-4-one |
| 7-Methoxyisoflavone |