Cbz-NH-PEG2-CH2COOH structure
|
Common Name | Cbz-NH-PEG2-CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 165454-06-8 | Molecular Weight | 297.30400 | |
| Density | N/A | Boiling Point | 506.6±45.0°C at 760 mmHg | |
| Molecular Formula | C14H19NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cbz-NH-PEG2-CH2COOHCbz-NH-PEG2-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Cbz-NH-PEG2-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Boiling Point | 506.6±45.0°C at 760 mmHg |
|---|---|
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.30400 |
| Exact Mass | 297.12100 |
| PSA | 97.58000 |
| LogP | 1.23500 |
| InChIKey | GWUWSVXMAZFFNT-UHFFFAOYSA-N |
| SMILES | O=C(O)COCCOCCNC(=O)OCc1ccccc1 |
| HS Code | 2934999090 |
|---|
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| AmbotzZAA1186 |
| 2-(2-(2-Benzyloxycarbonylaminoethoxy)ethoxy)acetic acid |
| 3-Oxo-1-phenyl-2,7,10-trioxa-4-azadodecan-12-oic acid |
| 8-Benzyloxycarbonylamino-3,6-dioxaoctanoic acid |