Tos-PEG4-CH2-Boc structure
|
Common Name | Tos-PEG4-CH2-Boc | ||
|---|---|---|---|---|
| CAS Number | 169751-73-9 | Molecular Weight | 462.554 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 550.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H34O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.4±30.1 °C | |
Use of Tos-PEG4-CH2-BocTos-PEG4-CH2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Tos-PEG5-CH2CO2t-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Tos-PEG4-CH2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 550.0±50.0 °C at 760 mmHg |
| Molecular Formula | C21H34O9S |
| Molecular Weight | 462.554 |
| Flash Point | 286.4±30.1 °C |
| Exact Mass | 462.192352 |
| LogP | 1.86 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | CZZJVKUJUYLGPU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCOCC(=O)OC(C)(C)C)cc1 |
| Hazard Codes | Xi |
|---|
| 2-Methyl-2-propanyl 14-{[(4-methylphenyl)sulfonyl]oxy}-3,6,9,12-tetraoxatetradecan-1-oate |
| 3,6,9,12-Tetraoxatetradecan-1-oic acid, 14-[[(4-methylphenyl)sulfonyl]oxy]-, 1,1-dimethylethyl ester |
| MFCD27977499 |