Azido-PEG5-PFP ester structure
|
Common Name | Azido-PEG5-PFP ester | ||
|---|---|---|---|---|
| CAS Number | 1818294-48-2 | Molecular Weight | 501.402 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24F5N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG5-PFP esterAzido-PEG5-PFP ester is a PEG- and Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
| Name | Azido-PEG5-PFP ester |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG5-PFP ester is a PEG- and Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C19H24F5N3O7 |
|---|---|
| Molecular Weight | 501.402 |
| Exact Mass | 501.153442 |
| LogP | 1.31 |
| InChIKey | YSQIHRPBWCEUAX-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| MFCD26793782 |
| 3,6,9,12,15-Pentaoxaoctadecan-18-oic acid, 1-azido-, 2,3,4,5,6-pentafluorophenyl ester |
| Pentafluorophenyl 1-azido-3,6,9,12,15-pentaoxaoctadecan-18-oate |