Bromoacetamido-C2-PEG2-NH-Boc structure
|
Common Name | Bromoacetamido-C2-PEG2-NH-Boc | ||
|---|---|---|---|---|
| CAS Number | 182244-33-3 | Molecular Weight | 369.252 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 506.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C13H25BrN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.1±30.1 °C | |
Use of Bromoacetamido-C2-PEG2-NH-BocBromoacetamido-C2-PEG2-NH-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-Methyl-2-propanyl [2-(2-{2-[(bromoacetyl)amino]ethoxy}ethoxy)ethyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | Bromoacetamido-C2-PEG2-NH-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 506.5±50.0 °C at 760 mmHg |
| Molecular Formula | C13H25BrN2O5 |
| Molecular Weight | 369.252 |
| Flash Point | 260.1±30.1 °C |
| Exact Mass | 368.094666 |
| LogP | 0.81 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | BLSNVTJXXUWHQT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNC(=O)CBr |
| Carbamic acid, N-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethyl]-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl [2-(2-{2-[(bromoacetyl)amino]ethoxy}ethoxy)ethyl]carbamate |