DCN1-UBC12-IN-2
Modify Date: 2025-08-27 14:17:58
DCN1-UBC12-IN-2 structure
|
Common Name | DCN1-UBC12-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 2374827-47-9 | Molecular Weight | 542.03 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H20ClN7O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DCN1-UBC12-IN-2DCN1-UBC12-IN-2 is a potent and specific DCN1-UBC12 inhibitor (IC50=9.55 nM). DCN1-UBC12-IN-2 could specifically target DCN1-UBC12 interaction and relieve Ang II-induced cardiac fibroblast activation[1]. |
| Name | DCN1-UBC12-IN-2 |
|---|
| Description | DCN1-UBC12-IN-2 is a potent and specific DCN1-UBC12 inhibitor (IC50=9.55 nM). DCN1-UBC12-IN-2 could specifically target DCN1-UBC12 interaction and relieve Ang II-induced cardiac fibroblast activation[1]. |
|---|---|
| Related Catalog | |
| In Vitro | DCN1-UBC12-IN-2 (DN-2) possesses relatively low cytotoxicity toward cardiac fibroblasts (CFs) with an IC50 of 27.34 μM for 24 h. |
| References |
| Molecular Formula | C23H20ClN7O3S2 |
|---|---|
| Molecular Weight | 542.03 |
| InChIKey | ZKZPHQPTGZBOHB-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2nc(SCc3ccc(Cl)cc3)nc(Sc3nnnn3C)c2C#N)cc(OC)c1OC |