Demethylasterriquinone B1 structure
|
Common Name | Demethylasterriquinone B1 | ||
|---|---|---|---|---|
| CAS Number | 78860-34-1 | Molecular Weight | 506.59200 | |
| Density | 1.335g/cm3 | Boiling Point | 780.2ºC at 760 mmHg | |
| Molecular Formula | C32H30N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 425.6ºC | |
Use of Demethylasterriquinone B1Demethylasterriquinone B1 is a selective insulin receptor activator. Demethylasterriquinone B1 stimulates tyrosine phosphorylation of the IR β subunit, and the activation of PIK3 and AKT[1]. |
| Name | 5-(7-but-2-enyl-1H-indol-3-yl)-3-hydroxy-2-(2-propan-2-yl-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Demethylasterriquinone B1 is a selective insulin receptor activator. Demethylasterriquinone B1 stimulates tyrosine phosphorylation of the IR β subunit, and the activation of PIK3 and AKT[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 780.2ºC at 760 mmHg |
| Molecular Formula | C32H30N2O4 |
| Molecular Weight | 506.59200 |
| Flash Point | 425.6ºC |
| Exact Mass | 506.22100 |
| PSA | 106.18000 |
| LogP | 7.01170 |
| Index of Refraction | 1.72 |
| InChIKey | XMGNJVXBPZAETK-UHFFFAOYSA-N |
| SMILES | C=CC(C)(C)c1[nH]c2ccccc2c1C1=C(O)C(=O)C(c2c[nH]c3c(CC=C(C)C)cccc23)=C(O)C1=O |
| Demethylasterriquinone B1 |