Bis-SS-C3-NHS ester structure
|
Common Name | Bis-SS-C3-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 98604-88-7 | Molecular Weight | 432.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20N2O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bis-SS-C3-NHS esterBis-SS-C3-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Bis-SS-C3-NHS ester |
|---|
| Description | Bis-SS-C3-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C16H20N2O8S2 |
|---|---|
| Molecular Weight | 432.47 |
| InChIKey | FCGMACUPMXOQJD-UHFFFAOYSA-N |
| SMILES | O=C(CCCSSCCCC(=O)ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |