MCHR1 antagonist 3 structure
|
Common Name | MCHR1 antagonist 3 | ||
|---|---|---|---|---|
| CAS Number | 1069622-60-1 | Molecular Weight | 472.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H36N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MCHR1 antagonist 3MCHR1 antagonist 3 is a potent the melanin-concentrating hormone receptor-1 (MCHR1) antagonist. MCHR1 antagonist 3 is used to regulate energy metabolism[1]. |
| Name | MCHR1 antagonist 3 |
|---|
| Description | MCHR1 antagonist 3 is a potent the melanin-concentrating hormone receptor-1 (MCHR1) antagonist. MCHR1 antagonist 3 is used to regulate energy metabolism[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Compound 1, derived from a spirohydantoin scaffold, exhibits a Ki of 50 nM at MCH-R1. Compound 1 is a potent inhibitor of CYP3A4 (IC50=35 nM). MCHR1 antagonist 3 is an analog of compound 1[1]. |
| References |
| Molecular Formula | C29H36N4O2 |
|---|---|
| Molecular Weight | 472.62 |
| InChIKey | RDDNGEWEYVTDBP-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)N(C2Cc3ccccc3C2)C(=O)C12CCN(Cc1ccc(N3CCCC3)cc1)CC2 |