Propargyl-PEG5-NHS ester structure
|
Common Name | Propargyl-PEG5-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1393330-40-9 | Molecular Weight | 401.408 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 497.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C18H27NO9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.8±31.5 °C | |
Use of Propargyl-PEG5-NHS esterPropargyl-PEG5-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | 1-(4,7,10,13,16-Pentaoxanonadec-18-ynoyloxy)-2,5-pyrrolidinedione |
|---|---|
| Synonym | More Synonyms |
| Description | Propargyl-PEG5-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 497.6±55.0 °C at 760 mmHg |
| Molecular Formula | C18H27NO9 |
| Molecular Weight | 401.408 |
| Flash Point | 254.8±31.5 °C |
| Exact Mass | 401.168579 |
| LogP | -2.68 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | ACZDUKRWTPZVRP-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| Storage condition | 2-8°C |
| 1-(4,7,10,13,16-Pentaoxanonadec-18-ynoyloxy)-2,5-pyrrolidinedione |
| 2,5-Pyrrolidinedione, 1-[(1-oxo-4,7,10,13,16-pentaoxanonadec-18-yn-1-yl)oxy]- |
| MFCD22574798 |