Bis-PEG5-NHS ester structure
|
Common Name | Bis-PEG5-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 756526-03-1 | Molecular Weight | 532.49500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H32N2O13 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of Bis-PEG5-NHS esterBis-PEG5-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Bis-PEG5-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Molecular Formula | C22H32N2O13 |
|---|---|
| Molecular Weight | 532.49500 |
| Exact Mass | 532.19000 |
| PSA | 173.51000 |
| InChIKey | FTYUGLBWKRXQBD-UHFFFAOYSA-N |
| SMILES | O=C(CCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| Bis-PEG5-NHS ester |
| AmbotzPEG1435 |
| BIS-SUCCINIMIDYL-4,7,10,13,16-PENTAOXANONADECANE-1,19-DIOATE |
| B3728 |
| Bis-dPEG5-NHS ester |