Azido-PEG5-NHS ester structure
|
Common Name | Azido-PEG5-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1433996-86-1 | Molecular Weight | 432.426 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H28N4O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG5-NHS esterAzido-PEG5-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Azido-PEG5-NHS ester |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG5-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C17H28N4O9 |
|---|---|
| Molecular Weight | 432.426 |
| Exact Mass | 432.185638 |
| LogP | -2.94 |
| InChIKey | UBITXOFSGXNPBW-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| AZIDO-PEG5-NHS |