Bis-Mal-Lysine-PEG4-TFP ester structure
|
Common Name | Bis-Mal-Lysine-PEG4-TFP ester | ||
|---|---|---|---|---|
| CAS Number | 1426164-53-5 | Molecular Weight | 843.773 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1012.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C37H45F4N5O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 565.9±34.3 °C | |
Use of Bis-Mal-Lysine-PEG4-TFP esterBis-Mal-Lysine-PEG4-TFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Bis-Mal-Lysine-PEG4-TFP ester |
|---|---|
| Synonym | More Synonyms |
| Description | Bis-Mal-Lysine-PEG4-TFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1012.1±65.0 °C at 760 mmHg |
| Molecular Formula | C37H45F4N5O13 |
| Molecular Weight | 843.773 |
| Flash Point | 565.9±34.3 °C |
| Exact Mass | 843.294983 |
| LogP | -0.59 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | QODWSCJQLAMMBN-SANMLTNESA-N |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCCCC(NC(=O)CCN1C(=O)C=CC1=O)C(=O)NCCOCCOCCOCCOCCC(=O)Oc1c(F)c(F)cc(F)c1F |
| Bis-MAL-Lysine-dPEG(R)4-TFP ester |
| 2,3,5,6-Tetrafluorophenyl 1-({N2,N6-bis[3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]lysyl}amino)-3,6,9,12-tetraoxapentadecan-15-oate |
| MFCD28385461 |
| 4,7,10,13-Tetraoxa-16,23-diazahexacosan-1-oic acid, 26-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-18-[[3-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]-17,24-dioxo-, 2,3,5,6-tetrafluorophenyl ester |