Lp-PLA2-IN-11
Modify Date: 2025-08-22 20:51:59
Lp-PLA2-IN-11 structure
|
Common Name | Lp-PLA2-IN-11 | ||
|---|---|---|---|---|
| CAS Number | 1620680-19-4 | Molecular Weight | 464.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H20F4N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Lp-PLA2-IN-11Lp-PLA2-IN-11 is a potent inhibitor of lipoprotein-associated phospholipase A2 (Lp-PLA2). Lp-PLA2 previously known as platelet- activating factor acetylhydrolase (PAF-AH), is a phospholipase A2 enzyme involved in hydrolysis of lipoprotein lipids or phospholipids. Lp-PLA2-IN-11 has the potential for the research of diseases associated with the activity of Lp-PLA2, for example atherosclerosis, Alzheimer's disease (extracted from patent WO2014114249A1, compound E145)[1]. |
| Name | Lp-PLA2-IN-11 |
|---|
| Description | Lp-PLA2-IN-11 is a potent inhibitor of lipoprotein-associated phospholipase A2 (Lp-PLA2). Lp-PLA2 previously known as platelet- activating factor acetylhydrolase (PAF-AH), is a phospholipase A2 enzyme involved in hydrolysis of lipoprotein lipids or phospholipids. Lp-PLA2-IN-11 has the potential for the research of diseases associated with the activity of Lp-PLA2, for example atherosclerosis, Alzheimer's disease (extracted from patent WO2014114249A1, compound E145)[1]. |
|---|---|
| Related Catalog | |
| Target |
Lp-PLA2[1] |
| References |
[1]. Zehong Wan, et al. Bicyclic pyrimidone compounds as inhibitors of lp-pla2. Patent WO2014114249A1. |
| Molecular Formula | C22H20F4N4O3 |
|---|---|
| Molecular Weight | 464.41 |
| InChIKey | WRAGBQQCIJKJRC-CYBMUJFWSA-N |
| SMILES | CC1CCn2c(cc(OCc3ccc(Oc4ccc(C(F)(F)F)nc4)c(F)c3)nc2=O)N1C |