Lp-PLA2-IN-4 structure
|
Common Name | Lp-PLA2-IN-4 | ||
|---|---|---|---|---|
| CAS Number | 2738877-91-1 | Molecular Weight | 495.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H18F5N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Lp-PLA2-IN-4Lp-PLA2-IN-4 is a potent inhibitor of lipoprotein-associated phospholipase A2 (Lp-PLA2). Lp-PLA2 previously known as platelet- activating factor acetylhydrolase (PAF-AH), is a phospholipase A2 enzyme involved in hydrolysis of lipoprotein lipids or phospholipids. Lp-PLA2-IN-4 has the potential for the research of diseases associated with the activity of Lp-PLA2, for example atherosclerosis, Alzheimer's disease (extracted from patent WO2021228159A1, compound 38)[1]. |
| Name | Lp-PLA2-IN-4 |
|---|
| Description | Lp-PLA2-IN-4 is a potent inhibitor of lipoprotein-associated phospholipase A2 (Lp-PLA2). Lp-PLA2 previously known as platelet- activating factor acetylhydrolase (PAF-AH), is a phospholipase A2 enzyme involved in hydrolysis of lipoprotein lipids or phospholipids. Lp-PLA2-IN-4 has the potential for the research of diseases associated with the activity of Lp-PLA2, for example atherosclerosis, Alzheimer's disease (extracted from patent WO2021228159A1, compound 38)[1]. |
|---|---|
| Related Catalog | |
| Target |
Lp-PLA2[1] |
| References |
| Molecular Formula | C23H18F5N3O4 |
|---|---|
| Molecular Weight | 495.40 |
| InChIKey | WQTLAEMFJNYZHB-MRXNPFEDSA-N |
| SMILES | O=c1nc(OCc2cc(F)c(Oc3cccc(C(F)(F)F)c3)c(F)c2)cc2n1CC1CN2CCO1 |