Hydroxy-PEG4-O-Boc structure
|
Common Name | Hydroxy-PEG4-O-Boc | ||
|---|---|---|---|---|
| CAS Number | 1807530-05-7 | Molecular Weight | 352.421 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 432.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C16H32O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.6±20.8 °C | |
Use of Hydroxy-PEG4-O-BocHydroxy-PEG5-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Hydroxy-PEG5-t-butyl acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Hydroxy-PEG5-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 432.4±40.0 °C at 760 mmHg |
| Molecular Formula | C16H32O8 |
| Molecular Weight | 352.421 |
| Flash Point | 142.6±20.8 °C |
| Exact Mass | 352.209717 |
| LogP | -0.60 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.454 |
| InChIKey | XPLBSNFHNMATJJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCOCCO |
| MFCD27977509 |
| 3,6,9,12,15-Pentaoxaheptadecan-1-oic acid, 17-hydroxy-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecan-1-oate |